cas: 6578-06-9 — see every product listed under this CAS number, including other names
5-Bromo-4-chloro-3-indolyl Phosphate p-Toluidine Salt [for Biochemical Research], >98.0%(T) (CAS 6578-06-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1239-100MG |
| cas | 6578-06-9 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 252.60 Pln | |
| TCI | 1g | 990.19 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline (CAS 6578-06-9) is a chemical compound with the molecular formula C15H15BrClN2O4P and a molecular weight of 433.62 g/mol. IUPAC name: (5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline. InChIKey: QEIFSLUFHRCVQL-UHFFFAOYSA-N.
| Molecular formula | C15H15BrClN2O4P |
|---|---|
| Molecular weight | 433.62 g/mol |
| IUPAC name | (5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline |
| InChIKey | QEIFSLUFHRCVQL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N.C1=CC(=C(C2=C1NC=C2OP(=O)(O)O)Cl)Br |
Computed by PubChem (NCBI)