cas: 6769-80-8 — see every product listed under this CAS number, including other names
5-Bromo-6-chloro-3-indolyl phosphate p-toluidine, 99.52% (CAS 6769-80-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-D0911-10 g |
| cas | 6769-80-8 |
| size | 10 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 4503.94 Pln | |
| MedChemExpress | 5 g | 2432.71 Pln | |
| MedChemExpress | 1 g | 728.36 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.52% |
(5-bromo-6-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline (CAS 6769-80-8) is a chemical compound with the molecular formula C15H15BrClN2O4P and a molecular weight of 433.62 g/mol. IUPAC name: (5-bromo-6-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline. InChIKey: WUHVYTJTZAKPOS-UHFFFAOYSA-N.
| Molecular formula | C15H15BrClN2O4P |
|---|---|
| Molecular weight | 433.62 g/mol |
| IUPAC name | (5-bromo-6-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline |
| InChIKey | WUHVYTJTZAKPOS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N.C1=C2C(=CC(=C1Br)Cl)NC=C2OP(=O)(O)O |
Computed by PubChem (NCBI)