cas: 68957-50-6 — see every product listed under this CAS number, including other names
5-Bromo-6-methyl-3-nitropyridin-2-amine, 95% (CAS 68957-50-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224330-5G |
| cas | 68957-50-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 674.78 Pln | |
| Fluorochem | 25g | 1252.70 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-6-methyl-3-nitropyridin-2-amine (CAS 68957-50-6) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-6-methyl-3-nitropyridin-2-amine. InChIKey: CRELZBHEKSIUDR-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-6-methyl-3-nitropyridin-2-amine |
| InChIKey | CRELZBHEKSIUDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=N1)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)