cas: 108158-00-5 — see every product listed under this CAS number, including other names
5-Bromothiophene-2-sulfonyl fluoride 95% (CAS 108158-00-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1072644-250mg |
| cas | 108158-00-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1405.00 Pln | |
| Ambeed | 5g | 4864.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1072644 |
5-bromothiophene-2-sulfonyl fluoride (CAS 108158-00-5) is a chemical compound with the molecular formula C4H2BrFO2S2 and a molecular weight of 245.1 g/mol. IUPAC name: 5-bromothiophene-2-sulfonyl fluoride. InChIKey: YZLKSNCDWSSCNL-UHFFFAOYSA-N.
| Molecular formula | C4H2BrFO2S2 |
|---|---|
| Molecular weight | 245.1 g/mol |
| IUPAC name | 5-bromothiophene-2-sulfonyl fluoride |
| InChIKey | YZLKSNCDWSSCNL-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)S(=O)(=O)F |
Computed by PubChem (NCBI)