cas: 1630906-47-6 — see every product listed under this CAS number, including other names
5-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE-2-CARBONITRILE, 97% (CAS 1630906-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504667-100MG |
| cas | 1630906-47-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2153.43 Pln | |
| Fluorochem | 250mg | 3533.15 Pln | |
| Fluorochem | 500mg | 5844.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile (CAS 1630906-47-6) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile. InChIKey: CYULQIWXOBZJIP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile |
| InChIKey | CYULQIWXOBZJIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=C2)C#N)Cl |
Computed by PubChem (NCBI)