cas: 2102411-05-0 — see every product listed under this CAS number, including other names
5-CHLOROQUINOLINE-3-CARBONITRILE, 97% (CAS 2102411-05-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F539886-100MG |
| cas | 2102411-05-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1075.68 Pln | |
| Fluorochem | 250mg | 1762.94 Pln | |
| Fluorochem | 1g | 4506.76 Pln | |
| Fluorochem | 5g | 13534.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-chloroquinoline-3-carbonitrile (CAS 2102411-05-0) is a chemical compound with the molecular formula C10H5ClN2 and a molecular weight of 188.61 g/mol. IUPAC name: 5-chloroquinoline-3-carbonitrile. InChIKey: VKDJXCCKDOGUBC-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 5-chloroquinoline-3-carbonitrile |
| InChIKey | VKDJXCCKDOGUBC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C#N)C(=C1)Cl |
Computed by PubChem (NCBI)