cas: 59376-81-7 — see every product listed under this CAS number, including other names
5-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine, 98% (CAS 59376-81-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A176310-5g |
| cas | 59376-81-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11657.80 Pln | |
| Fluorochem | 100mg | 1002.79 Pln | |
| Fluorochem | 250mg | 1950.37 Pln | |
| Fluorochem | 1g | 3158.28 Pln | |
| Fluorochem | 5g | 7261.00 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 59376-81-7) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: 5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: MPNOKRDWQNPAID-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | 5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | MPNOKRDWQNPAID-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC=C2)Cl)N |
Computed by PubChem (NCBI)