cas: 769-21-1 — see every product listed under this CAS number, including other names
5-Chloro-2,3-dihydrobenzofuran-3-amine, 95%, 95% (CAS 769-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116G58-100mg |
| cas | 769-21-1 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Chemat | 5g | 3496.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2,3-dihydro-1-benzofuran-3-amine (CAS 769-21-1) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: YAWYQNCCQCICHI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | YAWYQNCCQCICHI-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)