cas: 199596-24-2 — see every product listed under this CAS number, including other names
5-Chloro-2-(2-(phenyl(pyridin-2-yl)methylene)hydrazinyl)pyridine (CAS 199596-24-2) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 10mg, 50mg, 200mg, 5mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113C8F-2mg |
| cas | 199596-24-2 |
| size | 2mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 189.20 Pln | |
| Chemat | 10mg | 390.80 Pln | |
| Chemat | 50mg | 1077.20 Pln | |
| Chemat | 200mg | 2354.00 Pln | |
| Chemat | 5mg | 266.00 Pln | |
| Chemat | 25mg | 678.80 Pln | |
| Chemat | 100mg | 1696.40 Pln |
| delivery time | 3 weeks |
|---|
5-chloro-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine (CAS 199596-24-2) is a chemical compound with the molecular formula C17H13ClN4 and a molecular weight of 308.8 g/mol. IUPAC name: 5-chloro-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine. InChIKey: YHHFKWKMXWRVTJ-XLNRJJMWSA-N.
| Molecular formula | C17H13ClN4 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 5-chloro-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine |
| InChIKey | YHHFKWKMXWRVTJ-XLNRJJMWSA-N |
| SMILES | C1=CC=C(C=C1)/C(=N/NC2=NC=C(C=C2)Cl)/C3=CC=CC=N3 |
Computed by PubChem (NCBI)