cas: 866318-90-3 — see every product listed under this CAS number, including other names
5-Chloro-3-((trimethylsilyl)ethynyl)pyridin-2-amine 95+% (CAS 866318-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A723623-100mg |
| cas | 866318-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 470.50 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A723623 |
5-chloro-3-(2-trimethylsilylethynyl)pyridin-2-amine (CAS 866318-90-3) is a chemical compound with the molecular formula C10H13ClN2Si and a molecular weight of 224.76 g/mol. IUPAC name: 5-chloro-3-(2-trimethylsilylethynyl)pyridin-2-amine. InChIKey: ZZSDHUMNIBZFFM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2Si |
|---|---|
| Molecular weight | 224.76 g/mol |
| IUPAC name | 5-chloro-3-(2-trimethylsilylethynyl)pyridin-2-amine |
| InChIKey | ZZSDHUMNIBZFFM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(N=CC(=C1)Cl)N |
Computed by PubChem (NCBI)