cas: 79456-33-0 — see every product listed under this CAS number, including other names
5-Chloro-3-(trifluoromethyl)pyridin-2-amine 95% (CAS 79456-33-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A179190-5g |
| cas | 79456-33-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 548.38 Pln | |
| Ambeed | 25g | 1193.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A179190 |
5-chloro-3-(trifluoromethyl)pyridin-2-amine (CAS 79456-33-0) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 5-chloro-3-(trifluoromethyl)pyridin-2-amine. InChIKey: WPGLCXZKCAARBY-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 5-chloro-3-(trifluoromethyl)pyridin-2-amine |
| InChIKey | WPGLCXZKCAARBY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)