Products 886365-46-4

CAS 886365-46-4 is the registry number for 5-Chloro-3-methylpyridine-2-carboxylic acid, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

5-chloro-3-methylpyridine-2-carboxylic acid (CAS 886365-46-4) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 5-chloro-3-methylpyridine-2-carboxylic acid. InChIKey: QQNDJNHLMAFNJI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO2
Molecular weight171.58 g/mol
IUPAC name5-chloro-3-methylpyridine-2-carboxylic acid
InChIKeyQQNDJNHLMAFNJI-UHFFFAOYSA-N
SMILESCC1=CC(=CN=C1C(=O)O)Cl

Computed by PubChem (NCBI)