5-Chloro-4-(trifluoromethyl)pyridin-2-amine 97%
cas: 1095823-39-4 — see every product listed under this CAS number, including other names
5-Chloro-4-(trifluoromethyl)pyridin-2-amine 97% (CAS 1095823-39-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106767-100g |
| cas | 1095823-39-4 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 12930.50 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 915.50 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| Ambeed | 25g | 4086.12 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A106767 |
5-chloro-4-(trifluoromethyl)pyridin-2-amine (CAS 1095823-39-4) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 5-chloro-4-(trifluoromethyl)pyridin-2-amine. InChIKey: RVHOCQUEFYITIV-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 5-chloro-4-(trifluoromethyl)pyridin-2-amine |
| InChIKey | RVHOCQUEFYITIV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)