cas: 1227595-72-3 — see every product listed under this CAS number, including other names
5-Chloro-6-(trifluoromethyl)pyridin-2-amine, 98% (CAS 1227595-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601309-100MG |
| cas | 1227595-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 945.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-6-(trifluoromethyl)pyridin-2-amine (CAS 1227595-72-3) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 5-chloro-6-(trifluoromethyl)pyridin-2-amine. InChIKey: VPVLDKKSLCMFPO-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 5-chloro-6-(trifluoromethyl)pyridin-2-amine |
| InChIKey | VPVLDKKSLCMFPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C(F)(F)F)N |
Computed by PubChem (NCBI)