CAS 36157-45-6 appears in our catalog under these names: 5-Chlorothiophene-2,3-Dicarboxylic Acid, 5-chlorothiophene-2,3-dicarboxylic acid, 95%, 95%, 5-Chlorothiophene-2,3-dicarboxylic acid, 95%. Offered by: Chemat Brand, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: on request, 500mg, 100mg, 250mg, 1g.
5-chlorothiophene-2,3-dicarboxylic acid (CAS 36157-45-6) is a chemical compound with the molecular formula C6H3ClO4S and a molecular weight of 206.60 g/mol. IUPAC name: 5-chlorothiophene-2,3-dicarboxylic acid. InChIKey: QMTBVIGGYZIVBT-UHFFFAOYSA-N.
| Molecular formula | C6H3ClO4S |
|---|---|
| Molecular weight | 206.60 g/mol |
| IUPAC name | 5-chlorothiophene-2,3-dicarboxylic acid |
| InChIKey | QMTBVIGGYZIVBT-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)