CAS 155731-14-9 appears in our catalog under these names: 5–Chlorothiophene–2–sulfonic acid tert–butylamide, 5-Chlorothiophene-2-sulfonic acid tert-butylamide, 98%, 98%, 5-Chlorothiophene-2-sulfonic acid tert-butylamide, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
N-tert-butyl-5-chlorothiophene-2-sulfonamide (CAS 155731-14-9) is a chemical compound with the molecular formula C8H12ClNO2S2 and a molecular weight of 253.8 g/mol. IUPAC name: N-tert-butyl-5-chlorothiophene-2-sulfonamide. InChIKey: VPZSRWXWBIVADA-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S2 |
|---|---|
| Molecular weight | 253.8 g/mol |
| IUPAC name | N-tert-butyl-5-chlorothiophene-2-sulfonamide |
| InChIKey | VPZSRWXWBIVADA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(S1)Cl |
Computed by PubChem (NCBI)