cas: 1190310-15-6 — see every product listed under this CAS number, including other names
5-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde, ≥97%, ≥97% (CAS 1190310-15-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P4P-50mg |
| cas | 1190310-15-6 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 290.00 Pln | |
| Chemat | 250mg | 933.20 Pln | |
| Chemat | 1g | 2570.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde (CAS 1190310-15-6) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 5-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde. InChIKey: QILHLWLSZHECBY-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 5-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde |
| InChIKey | QILHLWLSZHECBY-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)C=O)F |
Computed by PubChem (NCBI)