cas: 1190316-08-5 — see every product listed under this CAS number, including other names
5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile, 96%, 96% (CAS 1190316-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P5T-100mg |
| cas | 1190316-08-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 659.60 Pln | |
| Chemat | 250mg | 1014.80 Pln | |
| Chemat | 1g | 2498.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile (CAS 1190316-08-5) is a chemical compound with the molecular formula C8H4FN3 and a molecular weight of 161.14 g/mol. IUPAC name: 5-fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile. InChIKey: WLQQBUDJBHLKML-UHFFFAOYSA-N.
| Molecular formula | C8H4FN3 |
|---|---|
| Molecular weight | 161.14 g/mol |
| IUPAC name | 5-fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile |
| InChIKey | WLQQBUDJBHLKML-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=C(C=C21)F)C#N |
Computed by PubChem (NCBI)