cas: 2387111-72-8 — see every product listed under this CAS number, including other names
5-Fluoro-2-hydroxy-3-iodobenzamide, 97% (CAS 2387111-72-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 500mg, 1g, 5g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1226561-10g |
| cas | 2387111-72-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 2452.66 Pln | |
| AmBeed | 25g | 4828.81 Pln | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 500mg | 435.28 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 5g | 1700.46 Pln | |
| Fluorochem | 10g | 2757.38 Pln | |
| Fluorochem | 25g | 5365.84 Pln | |
| Fluorochem | 100g | 14196.06 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-fluoro-2-hydroxy-3-iodobenzamide (CAS 2387111-72-8) is a chemical compound with the molecular formula C7H5FINO2 and a molecular weight of 281.02 g/mol. IUPAC name: 5-fluoro-2-hydroxy-3-iodobenzamide. InChIKey: ASTCIIXPVVJPSQ-UHFFFAOYSA-N.
| Molecular formula | C7H5FINO2 |
|---|---|
| Molecular weight | 281.02 g/mol |
| IUPAC name | 5-fluoro-2-hydroxy-3-iodobenzamide |
| InChIKey | ASTCIIXPVVJPSQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)N)O)I)F |
Computed by PubChem (NCBI)