cas: 1803811-31-5 — see every product listed under this CAS number, including other names
5-Fluoro-2-iodo-4-nitrotoluene, 97% (CAS 1803811-31-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A793800-5g |
| cas | 1803811-31-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 4132.24 Pln | |
| AmBeed | 250mg | 577.78 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 820.56 Pln | |
| Fluorochem | 5g | 2580.36 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-fluoro-4-iodo-5-methyl-2-nitrobenzene (CAS 1803811-31-5) is a chemical compound with the molecular formula C7H5FINO2 and a molecular weight of 281.02 g/mol. IUPAC name: 1-fluoro-4-iodo-5-methyl-2-nitrobenzene. InChIKey: MLIVWQOPSDLZDN-UHFFFAOYSA-N.
| Molecular formula | C7H5FINO2 |
|---|---|
| Molecular weight | 281.02 g/mol |
| IUPAC name | 1-fluoro-4-iodo-5-methyl-2-nitrobenzene |
| InChIKey | MLIVWQOPSDLZDN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1I)[N+](=O)[O-])F |
Computed by PubChem (NCBI)