cas: 436-72-6 — see every product listed under this CAS number, including other names
5-Fluoroquinazolin-4-ol, 97% (CAS 436-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | BTB04061DA |
| cas | 436-72-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 100.80 Pln | |
| Thermo Scientific | 5g | 276.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-fluoro-3H-quinazolin-4-one (CAS 436-72-6) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 5-fluoro-3H-quinazolin-4-one. InChIKey: UXEZULVIMJVIFB-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 5-fluoro-3H-quinazolin-4-one |
| InChIKey | UXEZULVIMJVIFB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)NC=N2 |
Computed by PubChem (NCBI)