CAS 27550-59-0 appears in our catalog under these names: 5–Hydroxyisobenzofuran–1,3–dione, 5-Hydroxyisobenzofuran-1,3-dione, 95%, 95%, 5-Hydroxyisobenzofuran-1,3-dione, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 25g, 100g.
5-hydroxy-2-benzofuran-1,3-dione (CAS 27550-59-0) is a chemical compound with the molecular formula C8H4O4 and a molecular weight of 164.11 g/mol. IUPAC name: 5-hydroxy-2-benzofuran-1,3-dione. InChIKey: PXHIYFMTRHEUHZ-UHFFFAOYSA-N.
| Molecular formula | C8H4O4 |
|---|---|
| Molecular weight | 164.11 g/mol |
| IUPAC name | 5-hydroxy-2-benzofuran-1,3-dione |
| InChIKey | PXHIYFMTRHEUHZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)OC2=O |
Computed by PubChem (NCBI)