5-Iodo-3-nitropyridin-2-ol, 97%
cas: 25391-59-7 — see every product listed under this CAS number, including other names
5-Iodo-3-nitropyridin-2-ol, 97% (CAS 25391-59-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F329739-1G |
| cas | 25391-59-7 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 482.14 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 470.50 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 338.00 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 503.18 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
5-iodo-3-nitro-1H-pyridin-2-one (CAS 25391-59-7) is a chemical compound with the molecular formula C5H3IN2O3 and a molecular weight of 265.99 g/mol. IUPAC name: 5-iodo-3-nitro-1H-pyridin-2-one. InChIKey: JCNPQYWDKONAFU-UHFFFAOYSA-N.
| Molecular formula | C5H3IN2O3 |
|---|---|
| Molecular weight | 265.99 g/mol |
| IUPAC name | 5-iodo-3-nitro-1H-pyridin-2-one |
| InChIKey | JCNPQYWDKONAFU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1I)[N+](=O)[O-] |
Computed by PubChem (NCBI)