5-Iodoquinolin-8-amine, 95%
cas: 142340-15-6 — see every product listed under this CAS number, including other names
5-Iodoquinolin-8-amine, 95% (CAS 142340-15-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A208887-250mg |
| cas | 142340-15-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1660.88 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1441.74 Pln | |
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 523.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-iodoquinolin-8-amine (CAS 142340-15-6) is a chemical compound with the molecular formula C9H7IN2 and a molecular weight of 270.07 g/mol. IUPAC name: 5-iodoquinolin-8-amine. InChIKey: UJCDMYCTCVPZME-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2 |
|---|---|
| Molecular weight | 270.07 g/mol |
| IUPAC name | 5-iodoquinolin-8-amine |
| InChIKey | UJCDMYCTCVPZME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)N)I |
Computed by PubChem (NCBI)
Synonyms:
5-Iodoquinolin-8-amine, 5-iodo-8-amino-quinoline