cas: 1198097-37-8 — see every product listed under this CAS number, including other names
5-Methoxy-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine, ≥95%, ≥95% (CAS 1198097-37-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PP0-50mg |
| cas | 1198097-37-8 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 602.00 Pln | |
| Chemat | 250mg | 1830.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(5-methoxypyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CAS 1198097-37-8) is a chemical compound with the molecular formula C17H28N2OSi and a molecular weight of 304.5 g/mol. IUPAC name: (5-methoxypyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane. InChIKey: LVZHYRFQHFARDO-UHFFFAOYSA-N.
| Molecular formula | C17H28N2OSi |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | (5-methoxypyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| InChIKey | LVZHYRFQHFARDO-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=CC(=CN=C21)OC |
Computed by PubChem (NCBI)