CAS 1643979-88-7 appears in our catalog under these names: 5-Methoxy-4-((4-methoxybenzyl)oxy)-2-nitrobenzoic acid, 98%, 5-Methoxy-4-((4-methoxybenzyl)oxy)-2-nitrobenzoic acid, 97%, 97%, 5-Methoxy-4-((4-methoxybenzyl)oxy)-2-nitrobenzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 25g, 10g, 100mg, 250mg.
5-methoxy-4-[(4-methoxyphenyl)methoxy]-2-nitrobenzoic acid (CAS 1643979-88-7) is a chemical compound with the molecular formula C16H15NO7 and a molecular weight of 333.29 g/mol. IUPAC name: 5-methoxy-4-[(4-methoxyphenyl)methoxy]-2-nitrobenzoic acid. InChIKey: HIVYTFMZOHFGAN-UHFFFAOYSA-N.
| Molecular formula | C16H15NO7 |
|---|---|
| Molecular weight | 333.29 g/mol |
| IUPAC name | 5-methoxy-4-[(4-methoxyphenyl)methoxy]-2-nitrobenzoic acid |
| InChIKey | HIVYTFMZOHFGAN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=C(C=C(C(=C2)[N+](=O)[O-])C(=O)O)OC |
Computed by PubChem (NCBI)