5-Nitro-2-(piperazin-1-yl)pyrimidine hydrochloride, 98%
cas: 3056401-50-1 — see every product listed under this CAS number, including other names
5-Nitro-2-(piperazin-1-yl)pyrimidine hydrochloride, 98% (CAS 3056401-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1H29RY-100mg |
| cas | 3056401-50-1 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 842.00 Pln | |
| Chemat | 1g | 2008.40 Pln | |
| Chemat | 5g | 6890.00 Pln | |
| Chemat | 10g | 9597.20 Pln | |
| Fluorochem | 100mg | 1138.16 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 1g | 3918.43 Pln | |
| Fluorochem | 5g | 11504.30 Pln | |
| Fluorochem | 10g | 18689.27 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitro-2-piperazin-1-ylpyrimidine;hydrochloride (CAS 3056401-50-1) is a chemical compound with the molecular formula C8H12ClN5O2 and a molecular weight of 245.67 g/mol. IUPAC name: 5-nitro-2-piperazin-1-ylpyrimidine;hydrochloride. InChIKey: KVYMFZFDFPUEBF-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN5O2 |
|---|---|
| Molecular weight | 245.67 g/mol |
| IUPAC name | 5-nitro-2-piperazin-1-ylpyrimidine;hydrochloride |
| InChIKey | KVYMFZFDFPUEBF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=C(C=N2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)