5-Nitrothiophene-2-carboxylic acid 95%
cas: 6317-37-9 — see every product listed under this CAS number, including other names
5-Nitrothiophene-2-carboxylic acid 95% (CAS 6317-37-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131259-1g |
| cas | 6317-37-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 815.38 Pln | |
| Ambeed | 500g | 3785.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131259 |
5-nitrothiophene-2-carboxylic acid (CAS 6317-37-9) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 5-nitrothiophene-2-carboxylic acid. InChIKey: UNEPVPOHGXLUIR-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 5-nitrothiophene-2-carboxylic acid |
| InChIKey | UNEPVPOHGXLUIR-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Nitro-2-thenoic acid, 5-Nitrothiophene-2-carboxylic acid, 5-Nitro-2-thiophenecarboxylic acid, 2-Thiophenecarboxylic acid, 5-nitro-, 5-Nitro-thiophene-2-carboxylic acid, 5-nitrothiophene-2carboxylic acid, 5-nitrothiophene-2-carboxylicacid, 5-nitrothiophene-2-carboxylic, 5-Nitrothiophene-2-carboxylic a, 5-Nitro-2-thienylcarboxylic acid