cas: 84272-85-5 — see every product listed under this CAS number, including other names
5-O-Methylvisammioside 98% (CAS 84272-85-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 1mg, 5mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A410653-1g |
| cas | 84272-85-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 3134.94 Pln | |
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 5mg | 197.94 Pln | |
| Ambeed | 25mg | 364.81 Pln | |
| Ambeed | 50mg | 565.06 Pln | |
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1210.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A410653 |
4-methoxy-7-methyl-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one (CAS 84272-85-5) is a chemical compound with the molecular formula C22H28O10 and a molecular weight of 452.5 g/mol. IUPAC name: 4-methoxy-7-methyl-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one. InChIKey: QVGFPTYGKPLXPK-NUTNSJPXSA-N.
| Molecular formula | C22H28O10 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 4-methoxy-7-methyl-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one |
| InChIKey | QVGFPTYGKPLXPK-NUTNSJPXSA-N |
| SMILES | CC1=CC(=O)C2=C(C3=C(C=C2O1)OC(C3)C(C)(C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC |
Computed by PubChem (NCBI)