cas: 51549-36-1 — see every product listed under this CAS number, including other names
5-O-TBDMS-N4-Benzoyl-2-deoxycytidine 98% (CAS 51549-36-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A836752-100mg |
| cas | 51549-36-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 3107.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A836752 |
N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (CAS 51549-36-1) is a chemical compound with the molecular formula C22H31N3O5Si and a molecular weight of 445.6 g/mol. IUPAC name: N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide. InChIKey: CCPOWNJNXQQIFV-YQVWRLOYSA-N.
| Molecular formula | C22H31N3O5Si |
|---|---|
| Molecular weight | 445.6 g/mol |
| IUPAC name | N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| InChIKey | CCPOWNJNXQQIFV-YQVWRLOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)