cas: 109904-26-9 — see every product listed under this CAS number, including other names
5-Trityl-5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one, 98%, 98% (CAS 109904-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M03-100mg |
| cas | 109904-26-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-trityl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one (CAS 109904-26-9) is a chemical compound with the molecular formula C26H23NOS and a molecular weight of 397.5 g/mol. IUPAC name: 5-trityl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one. InChIKey: QWWKINCXTMBNIV-UHFFFAOYSA-N.
| Molecular formula | C26H23NOS |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 5-trityl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
| InChIKey | QWWKINCXTMBNIV-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC(=O)SC21)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)