5-benzyl-5-azaspiro[2.4]heptan-7-ol, 97%
cas: 152719-37-4 — see every product listed under this CAS number, including other names
5-benzyl-5-azaspiro[2.4]heptan-7-ol, 97% (CAS 152719-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1333Q9-100mg |
| cas | 152719-37-4 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 500mg | 621.20 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2848.40 Pln | |
| Chemat | 10g | 4706.00 Pln | |
| Chemat | 25g | 9347.60 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 500mg | 1143.37 Pln | |
| Fluorochem | 1g | 1830.62 Pln | |
| Fluorochem | 5g | 5277.33 Pln | |
| Fluorochem | 10g | 8573.04 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-benzyl-5-azaspiro[2.4]heptan-7-ol (CAS 152719-37-4) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 5-benzyl-5-azaspiro[2.4]heptan-7-ol. InChIKey: AFJLHUVJNCKMKW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 5-benzyl-5-azaspiro[2.4]heptan-7-ol |
| InChIKey | AFJLHUVJNCKMKW-UHFFFAOYSA-N |
| SMILES | C1CC12CN(CC2O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)