cas: 2173992-38-4 — see every product listed under this CAS number, including other names
5-bromo-2-chloro-3-iodopyridin-4-amine, 97% (CAS 2173992-38-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A714340-5g |
| cas | 2173992-38-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8083.81 Pln | |
| AmBeed | 10g | 13422.01 Pln | |
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 500mg | 1716.08 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-2-chloro-3-iodopyridin-4-amine (CAS 2173992-38-4) is a chemical compound with the molecular formula C5H3BrClIN2 and a molecular weight of 333.35 g/mol. IUPAC name: 5-bromo-2-chloro-3-iodopyridin-4-amine. InChIKey: OEISVHUFAXIRCV-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClIN2 |
|---|---|
| Molecular weight | 333.35 g/mol |
| IUPAC name | 5-bromo-2-chloro-3-iodopyridin-4-amine |
| InChIKey | OEISVHUFAXIRCV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)I)N)Br |
Computed by PubChem (NCBI)