CAS 376-72-7 appears in our catalog under these names: 5H-Octafluoropentanoic acid, 95%, 5-H-Octafluoropentanoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 25g, 1g, 5g, 500mg.
2,2,3,3,4,4,5,5-octafluoropentanoic acid (CAS 376-72-7) is a chemical compound with the molecular formula C5H2F8O2 and a molecular weight of 246.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluoropentanoic acid. InChIKey: VGFKXVSMDOKOJZ-UHFFFAOYSA-N.
| Molecular formula | C5H2F8O2 |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluoropentanoic acid |
| InChIKey | VGFKXVSMDOKOJZ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)