Products 1016241-56-7
CAS 1016241-56-7 appears in our catalog under these names: 5H-Pyrrolo[2,3-b]pyrazine-6-carboxylic acid, 95%, 5H–Pyrrolo(2，3–b)pyrazine–6–carboxylic acid, 5H-Pyrrolo[2,3-b]pyrazine-6-carboxylic acid, 97%, 97%, 5H-Pyrrolo[2,3-b]pyrazine-6-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
5H-pyrrolo[2,3-b]pyrazine-6-carboxylic acid (CAS 1016241-56-7) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 5H-pyrrolo[2,3-b]pyrazine-6-carboxylic acid. InChIKey: SEMBRUAJJVJCEB-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5H-pyrrolo[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | SEMBRUAJJVJCEB-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)