Products 2241580-81-2
CAS 2241580-81-2 appears in our catalog under these names: 6'-BROMOSPIRO[CYCLOPROPANE-1,1'-ISOINDOLIN]-3'-ONE, 95%, 6'-Bromospiro[cyclopropane-1,1'-isoindolin]-3'-one 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-bromospiro[2H-isoindole-3,1'-cyclopropane]-1-one (CAS 2241580-81-2) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 5-bromospiro[2H-isoindole-3,1'-cyclopropane]-1-one. InChIKey: ZEGZZUOCSIIKNE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 5-bromospiro[2H-isoindole-3,1'-cyclopropane]-1-one |
| InChIKey | ZEGZZUOCSIIKNE-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=CC(=C3)Br)C(=O)N2 |
Computed by PubChem (NCBI)