cas: 4066-02-8 — see every product listed under this CAS number, including other names
6,6'-Methylenebis(2-cyclohexyl-4-methylphenol) (CAS 4066-02-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242606-1G |
| cas | 4066-02-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 487.35 Pln | |
| Fluorochem | 100g | 1731.70 Pln |
| delivery time | 3-4 weeks |
|---|
2-cyclohexyl-6-[(3-cyclohexyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol (CAS 4066-02-8) is a chemical compound with the molecular formula C27H36O2 and a molecular weight of 392.6 g/mol. IUPAC name: 2-cyclohexyl-6-[(3-cyclohexyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol. InChIKey: AKNMPWVTPUHKCG-UHFFFAOYSA-N.
| Molecular formula | C27H36O2 |
|---|---|
| Molecular weight | 392.6 g/mol |
| IUPAC name | 2-cyclohexyl-6-[(3-cyclohexyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
| InChIKey | AKNMPWVTPUHKCG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C2CCCCC2)O)CC3=C(C(=CC(=C3)C)C4CCCCC4)O |
Computed by PubChem (NCBI)