cas: 32737-35-2 — see every product listed under this CAS number, including other names
6,6′,7,7′-Tetrahydroxy-4,4,4′,4′-tetramethyl-2,2′-spirobichroman 95+% (CAS 32737-35-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A514223-250mg |
| cas | 32737-35-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 10g | 1694.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A514223 |
4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-6,6',7,7'-tetrol (CAS 32737-35-2) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-6,6',7,7'-tetrol. InChIKey: SZUGPQFFJXSTDD-UHFFFAOYSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-6,6',7,7'-tetrol |
| InChIKey | SZUGPQFFJXSTDD-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC(C3=CC(=C(C=C3O2)O)O)(C)C)OC4=CC(=C(C=C41)O)O)C |
Computed by PubChem (NCBI)