6,6-Difluoro-2-azaspiro[3.3]heptane 2,2,2-trifluoroacetate, 98%, 98%
cas: 1427367-47-2 — see every product listed under this CAS number, including other names
6,6-Difluoro-2-azaspiro[3.3]heptane 2,2,2-trifluoroacetate, 98%, 98% (CAS 1427367-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKPT-100mg |
| cas | 1427367-47-2 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 659.60 Pln | |
| Chemat | 5g | 1898.00 Pln | |
| Chemat | 25g | 8882.00 Pln | |
| Chemat | 500mg | 477.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6,6-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid (CAS 1427367-47-2) is a chemical compound with the molecular formula C8H10F5NO2 and a molecular weight of 247.16 g/mol. IUPAC name: 6,6-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid. InChIKey: VADHXGWRJYIASW-UHFFFAOYSA-N.
| Molecular formula | C8H10F5NO2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 6,6-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid |
| InChIKey | VADHXGWRJYIASW-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(F)F)CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
6,6-Difluoro-2-azaspiro[3.3]heptane 2,2,2-trifluoroacetate, 6,6-Difluoro-2-aza-spiro[3.3]heptane trifluoroacetate, 6,6-difluoro-2-azaspiro[3.3]heptane trifluoroacetate, 6,6-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid, 2,2-Difluoro-6-azaspiro[3.3]heptane; 2,2,2-trifluoroacetic acid, VADHXGWRJYIASW-UHFFFAOYSA-N, 6,6-Difluoro-2-azaspiro[3.3]heptane TFA, 6,6-Difluoro-2-aza-spiro-[3.3]heptane trifluoroacetate, 6,6-Difluoro-2-azaspiro[3.3]heptane2,2,2-trifluoroacetate, 6,6-Difluoro-2-aza-spiro[3.3]heptane trifluoroacetate - D7178