cas: 130120-68-2 — see every product listed under this CAS number, including other names
6,8-Dichloro-7H-purin-2-ylamine 98% (CAS 130120-68-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A929335-250mg |
| cas | 130120-68-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 642.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A929335 |
6,8-dichloro-7H-purin-2-amine (CAS 130120-68-2) is a chemical compound with the molecular formula C5H3Cl2N5 and a molecular weight of 204.01 g/mol. IUPAC name: 6,8-dichloro-7H-purin-2-amine. InChIKey: TVRLITZXKLOOBY-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N5 |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 6,8-dichloro-7H-purin-2-amine |
| InChIKey | TVRLITZXKLOOBY-UHFFFAOYSA-N |
| SMILES | C12=C(N=C(N=C1Cl)N)N=C(N2)Cl |
Computed by PubChem (NCBI)