cas: 153851-71-9 — see every product listed under this CAS number, including other names
6,7-dihydro-6-mercapto-5H-Pyrazolo[1,2-a][1,2,4]triazol-4-ium chloride, 96%, 96% (CAS 153851-71-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118HI4-250mg |
| cas | 153851-71-9 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 100mg | 78.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride (CAS 153851-71-9) is a chemical compound with the molecular formula C5H8ClN3S and a molecular weight of 177.66 g/mol. IUPAC name: 6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride. InChIKey: HPBXUFOSZBCEIQ-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN3S |
|---|---|
| Molecular weight | 177.66 g/mol |
| IUPAC name | 6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride |
| InChIKey | HPBXUFOSZBCEIQ-UHFFFAOYSA-N |
| SMILES | C1C(C[N+]2=CN=CN21)S.[Cl-] |
Computed by PubChem (NCBI)