cas: 399549-96-3 — see every product listed under this CAS number, including other names
6-((2-Aminoethyl)amino)-5-chloropyrimidine-2,4(1H,3H)-dione hydrochloride, 95%, 95% (CAS 399549-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A49-100mg |
| cas | 399549-96-3 |
| size | 100mg |
| availability | 1.89g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 1g | 4542.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(2-aminoethylamino)-5-chloro-1H-pyrimidine-2,4-dione;hydrochloride (CAS 399549-96-3) is a chemical compound with the molecular formula C6H10Cl2N4O2 and a molecular weight of 241.07 g/mol. IUPAC name: 6-(2-aminoethylamino)-5-chloro-1H-pyrimidine-2,4-dione;hydrochloride. InChIKey: GFMYSAWNUFDLEE-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl2N4O2 |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 6-(2-aminoethylamino)-5-chloro-1H-pyrimidine-2,4-dione;hydrochloride |
| InChIKey | GFMYSAWNUFDLEE-UHFFFAOYSA-N |
| SMILES | C(CNC1=C(C(=O)NC(=O)N1)Cl)N.Cl |
Computed by PubChem (NCBI)