cas: 55403-35-5 — see every product listed under this CAS number, including other names
6-(4-Methylpiperazin-1-yl)pyridin-3-amine, 98%, 98% (CAS 55403-35-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCR2-250mg |
| cas | 55403-35-5 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 25g | 1350.80 Pln | |
| Chemat | 10g | 587.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(4-methylpiperazin-1-yl)pyridin-3-amine (CAS 55403-35-5) is a chemical compound with the molecular formula C10H16N4 and a molecular weight of 192.26 g/mol. IUPAC name: 6-(4-methylpiperazin-1-yl)pyridin-3-amine. InChIKey: NZTCEWZBMOTKCJ-UHFFFAOYSA-N.
| Molecular formula | C10H16N4 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 6-(4-methylpiperazin-1-yl)pyridin-3-amine |
| InChIKey | NZTCEWZBMOTKCJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)