cas: 1330172-81-0 — see every product listed under this CAS number, including other names
6-(Butylamino)-N-(2,6-dimethylphenyl)hexanamide (Bupivacaine Impurity), 95%, 95% (CAS 1330172-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110FR5-250mg |
| cas | 1330172-81-0 |
| size | 250mg |
| availability | 1.25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 8651.60 Pln | |
| Chemat | 1mg | 251.60 Pln | |
| Chemat | 5mg | 549.20 Pln | |
| Chemat | 10mg | 846.80 Pln | |
| Chemat | 25mg | 1547.60 Pln | |
| Chemat | 50mg | 2589.20 Pln | |
| Chemat | 100mg | 4355.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(butylamino)-N-(2,6-dimethylphenyl)hexanamide (CAS 1330172-81-0) is a chemical compound with the molecular formula C18H30N2O and a molecular weight of 290.4 g/mol. IUPAC name: 6-(butylamino)-N-(2,6-dimethylphenyl)hexanamide. InChIKey: KXUVXFMERBRLDR-UHFFFAOYSA-N.
| Molecular formula | C18H30N2O |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 6-(butylamino)-N-(2,6-dimethylphenyl)hexanamide |
| InChIKey | KXUVXFMERBRLDR-UHFFFAOYSA-N |
| SMILES | CCCCNCCCCCC(=O)NC1=C(C=CC=C1C)C |
Computed by PubChem (NCBI)