6-(Di-Boc-amino)pyridine-2-boronic Acid Pinacol Ester, 95%, 95%
cas: 1310384-87-2 — see every product listed under this CAS number, including other names
6-(Di-Boc-amino)pyridine-2-boronic Acid Pinacol Ester, 95%, 95% (CAS 1310384-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BZU-100mg |
| cas | 1310384-87-2 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6746.00 Pln | |
| Chemat | 10g | 10058.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (CAS 1310384-87-2) is a chemical compound with the molecular formula C21H33BN2O6 and a molecular weight of 420.3 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate. InChIKey: VKNZXYHMNGMQRP-UHFFFAOYSA-N.
| Molecular formula | C21H33BN2O6 |
|---|---|
| Molecular weight | 420.3 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| InChIKey | VKNZXYHMNGMQRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)