cas: 1806775-39-2 — see every product listed under this CAS number, including other names
6-(Difluoromethyl)-5-methylpyridine-3-carboxamide, 95%, 95% (CAS 1806775-39-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNL7-250mg |
| cas | 1806775-39-2 |
| size | 250mg |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1854.80 Pln | |
| Chemat | 5g | 5080.40 Pln | |
| Chemat | 10g | 8675.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(difluoromethyl)-5-methylpyridine-3-carboxamide (CAS 1806775-39-2) is a chemical compound with the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. IUPAC name: 6-(difluoromethyl)-5-methylpyridine-3-carboxamide. InChIKey: ILPTZNZFHWIRKC-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 6-(difluoromethyl)-5-methylpyridine-3-carboxamide |
| InChIKey | ILPTZNZFHWIRKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(F)F)C(=O)N |
Computed by PubChem (NCBI)