6-(Piperazine-1-carbonyl)-1h-pyrimidine-2,4-dione hydrochloride, 97%
cas: 4318-57-4 — see every product listed under this CAS number, including other names
6-(Piperazine-1-carbonyl)-1h-pyrimidine-2,4-dione hydrochloride, 97% (CAS 4318-57-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1225217-5g |
| cas | 4318-57-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18180.82 Pln | |
| AmBeed | 10g | 21982.66 Pln | |
| Fluorochem | 100mg | 1226.67 Pln | |
| Fluorochem | 250mg | 1606.74 Pln | |
| Fluorochem | 500mg | 2601.19 Pln | |
| Fluorochem | 1g | 4069.42 Pln | |
| Chemat | 100mg | 731.60 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 500mg | 1552.40 Pln | |
| Chemat | 1g | 2440.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-(piperazine-1-carbonyl)-1H-pyrimidine-2,4-dione;hydrochloride (CAS 4318-57-4) is a chemical compound with the molecular formula C9H13ClN4O3 and a molecular weight of 260.68 g/mol. IUPAC name: 6-(piperazine-1-carbonyl)-1H-pyrimidine-2,4-dione;hydrochloride. InChIKey: UHVGVQULJZFPBP-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4O3 |
|---|---|
| Molecular weight | 260.68 g/mol |
| IUPAC name | 6-(piperazine-1-carbonyl)-1H-pyrimidine-2,4-dione;hydrochloride |
| InChIKey | UHVGVQULJZFPBP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=O)NC(=O)N2.Cl |
Computed by PubChem (NCBI)
Synonyms:
6-(piperazine-1-carbonyl)-1H-pyrimidine-2,4-dione hydrochloride, 6-(piperazine-1-carbonyl)-1H-pyrimidine-2,4-dione;hydrochloride, 6-(Piperazine-1-carbonyl)pyrimidine-2,4(1H,3H)-dione Hydrochloride, 6-(piperazine-1-carbonyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride, C9H13ClN4O3, 6-(Piperazine-1-carbonyl)-1,3-dihydropyrimidine-2,4-dione HCl