6-(Trifluoromethyl)pyridine-2,3-diamine, 95%, 95%
cas: 683242-79-7 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)pyridine-2,3-diamine, 95%, 95% (CAS 683242-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11758A-100mg |
| cas | 683242-79-7 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 856.40 Pln | |
| Chemat | 250mg | 1490.00 Pln | |
| Chemat | 1g | 3630.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)pyridine-2,3-diamine (CAS 683242-79-7) is a chemical compound with the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. IUPAC name: 6-(trifluoromethyl)pyridine-2,3-diamine. InChIKey: MUAUJMRIVQEHHZ-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | 6-(trifluoromethyl)pyridine-2,3-diamine |
| InChIKey | MUAUJMRIVQEHHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1N)N)C(F)(F)F |
Computed by PubChem (NCBI)