cas: 438564-37-5 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)pyridine-3,4-diamine 95% (CAS 438564-37-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A671235-100mg |
| cas | 438564-37-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 6516.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A671235 |
6-(trifluoromethyl)pyridine-3,4-diamine (CAS 438564-37-5) is a chemical compound with the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. IUPAC name: 6-(trifluoromethyl)pyridine-3,4-diamine. InChIKey: ZXYMLNXDEYTMJX-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | 6-(trifluoromethyl)pyridine-3,4-diamine |
| InChIKey | ZXYMLNXDEYTMJX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)N)N |
Computed by PubChem (NCBI)