cas: 1251012-02-8 — see every product listed under this CAS number, including other names
6-(tert-Butyl) 2-ethyl 4,5,7,8-tetrahydro-6H-thiazolo(4,5-d)azepine-2,6-dicarboxylate, 95% (CAS 1251012-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A752535-100mg |
| cas | 1251012-02-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 5987.59 Pln | |
| AmBeed | 250mg | 10707.34 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-O-tert-butyl 2-O-ethyl 4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxylate (CAS 1251012-02-8) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 6-O-tert-butyl 2-O-ethyl 4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxylate. InChIKey: ZJADFVCBCTWNLC-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 6-O-tert-butyl 2-O-ethyl 4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxylate |
| InChIKey | ZJADFVCBCTWNLC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(S1)CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)